Izvorni kod stranice Pradofloksacin

{{Drugbox-lat
| Verifiedfields = 
| Watchedfields = 
| verifiedrevid = 407868681
| IUPAC_name = 8-Cijano-1-ciklopropil-7-(1S,6S)-2,8-diazabiciklo-(4.3.0)nonan-8-il)-6-fluoro-1,4-dihidro-4-okso-3-hinolin karboksilna kiselina
| image = Pradofloxacin.png

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 6O0T5E048I
| CAS_number = 195532-12-8
| ATCvet = yes
| ATC_prefix = J01
| ATC_suffix = MA97
| ATC_supplemental =
| PubChem           = 
| PubChemSubstance  = 
| IUPHAR_ligand     = 
| ChEMBL_Ref        =
| DrugBank          = 
| ChemSpiderID      = 7978646
| KEGG              = 
| ChEBI             = 
| ChEMBL            = 
| DrugBank_Ref      =
| synonyms          =

<!--Chemical data-->
| chemical_formula = 
| C=21 | H=21 | F=1 | N=4 | O=3 
| molecular_weight = 396,42 g/mol
| smiles            = C1C[C@H]2CN(C[C@H]2NC1)C3=C(C=C4C(=C3C#N)N(C=C(C4=O)C(=O)O)C5CC5)F
| StdInChI          = InChI=1S/C21H21FN4O3/c22-16-6-13-18(26(12-3-4-12)9-15(20(13)27)21(28)29)14(7-23)19(16)25-8-11-2-1-5-24-17(11)10-25/h6,9,11-12,17,24H,1-5,8,10H2,(H,28,29)/t11-,17+/m0/s1
| StdInChIKey_Ref   = {{stdinchicite|correct|chemspider}}
| StdInChI_comment  = 
| StdInChIKey       = LZLXHGFNOWILIY-APPDUMDISA-N
| StdStdInChI_Ref   = {{stdinchicite|correct|chemspider}}
| density           = 
| melting_point     = 
| melting_high      = 
| melting_notes     = 
| boiling_point     = 
| boiling_notes     = 
| solubility        = 
| specific_rotation = 
| sec_combustion    =
}}

'''Pradofloksacin''' (prodajno ime ''Veraflox'') je treća generacija [[veterina]]rskih antibiotika iz [[fluorohinolon]]ske klase. Ovaj lek je [[Evropska komisija]] odobrila aprila 2011. za veterinarsku primenu na recepat za tretiranje [[bakterija|bakterijskih]] infekcija kod pasa i mačaka.<ref name="Europa">{{cite web|url=http://ec.europa.eu/health/documents/community-register/html/v107.htm |title=Community register of veterinary medicinal products |publisher=Ec.europa.eu |date= |accessdate = 20. 6. 2012.}}</ref>

== Povezano ==
* [[Hinolon]]

== Reference ==
{{reflist}}

== Spoljašnje veze ==
{{Portal-lat|Medicina|Hemija}}
* [http://www.ema.europa.eu/docs/en_GB/document_library/EPAR_-_Product_Information/veterinary/000159/WC500109014.pdf Summary of Product Characteristics] {{Webarchive|url=https://web.archive.org/web/20170202052302/http://www.ema.europa.eu/docs/en_GB/document_library/EPAR_-_Product_Information/veterinary/000159/WC500109014.pdf |date=2017-02-02 }}

{{Antibiotici inhibitori nukleinskih kiselina-lat}}

[[Kategorija:Hinolonski antibiotici]]
[[Kategorija:Organofluoridi]]
[[Kategorija:Nitrili]]
[[Kategorija:Pirolopiridini]]
[[Kategorija:Ciklopropani]]