Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Acrisorcin: Difference between pages
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 464942404 of page Acrisorcin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number'). |
Entranced98 (talk | contribs) Importing Wikidata short description: "Chemical compound" |
||
| Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Acrisorcin|oldid=464942404}} 464942404] of page [[Acrisorcin]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
| Watchedfields = changed |
|||
| image = Acrisorcin.png |
| image = Acrisorcin.png |
||
| verifiedrevid = |
| verifiedrevid = 477241233 |
||
<!--Combo data--> |
<!--Combo data--> |
||
| type = combo |
| type = combo |
||
| component1 = 9-Aminoacridine |
| component1 = 9-Aminoacridine |
||
| class1 = |
| class1 = [[Antiseptic]] |
||
| component2 = 4-Hexylresorcinol |
| component2 = 4-Hexylresorcinol |
||
| class2 = |
| class2 = Antiseptic |
||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
||
| pregnancy_US = <!-- A / B / C / D / X --> |
| pregnancy_US = <!-- A / B / C / D / X --> |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
||
| legal_status = |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|changed|??}} |
| CAS_number_Ref = {{cascite|changed|??}} |
||
| CAS_number = |
| CAS_number = 7527-91-5 |
||
| ATC_prefix = none |
| ATC_prefix = none |
||
| ATC_suffix = |
| ATC_suffix = |
||
| PubChem = 24144 |
| PubChem = 24144 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = |
| DrugBank = |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 22568 |
| ChemSpiderID = 22568 |
||
| Line 39: | Line 37: | ||
| KEGG = D02759 |
| KEGG = D02759 |
||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
||
| ChEMBL = |
| ChEMBL = 1201038 |
||
<!--Chemical data--> |
|||
| smiles = Oc1cc(O)c(cc1)CCCCCC.n1c3c(c(c2c1cccc2)N)cccc3 |
|||
| InChI = 1/C13H10N2.C12H18O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-2-3-4-5-6-10-7-8-11(13)9-12(10)14/h1-8H,(H2,14,15);7-9,13-14H,2-6H2,1H3 |
|||
| InChIKey = YZODJQFXMFEJRM-UHFFFAOYAT |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/C13H10N2.C12H18O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-2-3-4-5-6-10-7-8-11(13)9-12(10)14/h1-8H,(H2,14,15);7-9,13-14H,2-6H2,1H3 |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChIKey = YZODJQFXMFEJRM-UHFFFAOYSA-N |
|||
}} |
}} |
||
'''Acrisorcin''' is a topical anti-infective typically used as a [[fungicide]].<ref>{{Cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/24144|title=Acrisorcin| work = PubChem | publisher = U.S. National Library of Medicine |language=en|access-date=2019-03-26}}</ref> It is a combination of the active ingredients [[9-aminoacridine]] and [[Hexylresorcinol|4-hexylresorcinol]].<ref>{{Cite web|url=https://echa.europa.eu/substance-information/-/substanceinfo/100.028.536|title=Acrisorcin - Substance Information | publisher = European Chemicals Agency (ECHA) |language=en-GB|access-date=2019-03-26}}</ref> |
|||
__TOC__ |
|||
==History== |
|||
Acrisorcin was marketed as a cream under the trade name '''Akrinol''', which has since been discontinued. It was developed at [[Indiana State University]] in 1961.<ref name="JAMA">{{cite journal | vauthors = <!-- No authors listed -->| title = A new agent for the control of tinea versicolor. Acrisorcin (Akrinol) | journal = JAMA | volume = 196 | issue = 11 | pages = 1010 | date = June 1966 | pmid = 5952419 | doi = 10.1001/jama.1966.03100240144035 }}</ref> |
|||
==Indications== |
|||
Acrisorcin was used to combat [[pityriasis versicolor]].<ref name="JAMA" /> |
|||
== References == |
|||
{{Reflist}} |
|||
[[Category:Antifungals]] |
|||
[[Category:Combination drugs]] |
|||
{{antimicrobial-stub}} |
|||