Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and CHAPS detergent: Difference between pages
Appearance
(Difference between pages)
Content deleted Content added
Saving copy of the {{chembox}} taken from revid 469888543 of page CHAPS_detergent for the Chem/Drugbox validation project (updated: 'StdInChI', 'StdInChIKey'). |
m Open access bot: doi added to citation with #oabot. |
||
Line 1: | Line 1: | ||
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:CHAPS_detergent|oldid=469888543}} 469888543] of page [[CHAPS_detergent]] with values updated to verified values.}} |
|||
{{Chembox |
{{Chembox |
||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
| Watchedfields = changed |
|||
| |
| verifiedrevid = 470456710 |
||
| ImageFile = CHAPS.png |
|||
| ImageName = Structural formula of CHAPS detergent |
| ImageFile = CHAPS.png |
||
| ImageName = Structural formula of CHAPS detergent |
|||
| IUPACName = 3-<nowiki/>{Dimethyl[3-(3α,7α,12α-trihydroxy-5β-cholan-24-amido)propyl]azaniumyl}propane-1-sulfonate |
|||
⚫ | |||
| SystematicName = 3-[Dimethyl(3-<nowiki/>{(4''R'')-4-[(1'''R'',3a''S'',3b''R'',4''R'',5a''S'',7''R'',9a''S'',9b''S'',11''S'',11a''R'')-4,7,11-trihydroxy-9a,11a-dimethylhexadecahydro-1''H''-cyclopenta[''a'']phenanthren-1-yl]pentanamido}propyl)azaniumyl]propane-1-sulfonate |
|||
propanesulfonate |
|||
⚫ | |||
| SystematicName = 3-{Dimethyl[3-(4-{5,9,16-trihydroxy-2,15-<br /> |
|||
⚫ | |||
dimethyltetracyclo[8.7.0.0<sup>2,7</sup>.0<sup>11,15</sup>]<br /> |
|||
⚫ | |||
heptadecan-14-yl}pentanamido)propyl]<br /> |
|||
⚫ | |||
azaniumyl}propane-1-sulfonate |
|||
| OtherNames = 3-{Dimethyl[3-(4-{5,9,16-trihydroxy-2,15-<br /> |
|||
dimethyltetracyclo[8.7.0.0<sup>2,7</sup>.0<sup>11,15</sup>]<br /> |
|||
heptadecan-14-yl}pentanamido)propyl]aminio}<br /> |
|||
propane-1-sulfonate |
|||
⚫ | |||
⚫ | |||
⚫ | |||
| InChIKey = UMCMPZBLKLEWAF-BCTGSCMUBQ |
| InChIKey = UMCMPZBLKLEWAF-BCTGSCMUBQ |
||
| SMILES1 = [O-]S(=O)(=O)CCC[N+](C)(C)CCCNC(=O)CC[C@@H](C)[C@H]4CC[C@H]3[C@H]2[C@@H]([C@@]1([C@@H](C[C@H](O)CC1)C[C@H]2O)C)C[C@H](O)[C@@]34C |
| SMILES1 = [O-]S(=O)(=O)CCC[N+](C)(C)CCCNC(=O)CC[C@@H](C)[C@H]4CC[C@H]3[C@H]2[C@@H]([C@@]1([C@@H](C[C@H](O)CC1)C[C@H]2O)C)C[C@H](O)[C@@]34C |
||
Line 23: | Line 16: | ||
| InChIKey1 = UMCMPZBLKLEWAF-BCTGSCMUSA-N |
| InChIKey1 = UMCMPZBLKLEWAF-BCTGSCMUSA-N |
||
| CASNo = 75621-03-3 |
| CASNo = 75621-03-3 |
||
| |
| CASNo_Ref = {{cascite|correct|CAS}} |
||
| |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = QBP25342AG |
|||
⚫ | |||
| ChEMBL = 450950 |
| ChEMBL = 450950 |
||
| PubChem = 107670 |
| PubChem = 107670 |
||
⚫ | |||
| PubChem_Ref = {{Pubchemcite}} |
|||
⚫ | |||
⚫ | |||
⚫ | |||
16''S'') |
16''S'') |
||
⚫ | |||
| PubChem1_Ref = {{Pubchemcite}} |
|||
⚫ | |||
⚫ | |||
⚫ | |||
16''S'') |
16''S'') |
||
⚫ | |||
| PubChem2_Ref = {{Pubchemcite}} |
|||
⚫ | |||
⚫ | |||
⚫ | |||
15''R'',16''S'') |
15''R'',16''S'') |
||
⚫ | |||
| PubChem3_Ref = {{Pubchemcite}} |
|||
⚫ | |||
⚫ | |||
⚫ | |||
14''R'',15''R'',16''S'') |
14''R'',15''R'',16''S'') |
||
⚫ | |||
| PubChem4_Ref = {{Pubchemcite}} |
|||
⚫ | |||
⚫ | |||
⚫ | |||
(2''S'',5''R'',14''R'',15''S'',16''S'') |
(2''S'',5''R'',14''R'',15''S'',16''S'') |
||
⚫ | |||
| PubChem5_Ref = {{Pubchemcite}} |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
⚫ | |||
| |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
⚫ | |||
| KEGG = C11321 |
| KEGG = C11321 |
||
| |
| MeSHName = 3-((3-Cholamidopropyl)dimethylammonium)-1-propanesulfonate |
||
| |
| SMILES = CC(CCC(=O)NCCC[N+](C)(C)CCCS([O-])(=O)=O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C |
||
| |
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
||
| StdInChI = 1S/C32H58N2O7S/c1-21(8-11-29(38)33-14-6-15-34(4,5)16-7-17-42(39,40)41)24-9-10-25-30-26(20-28(37)32(24,25)3)31(2)13-12-23(35)18-22(31)19-27(30)36/h21-28,30,35-37H,6-20H2,1-5H3,(H-,33,38,39,40,41) |
| StdInChI = 1S/C32H58N2O7S/c1-21(8-11-29(38)33-14-6-15-34(4,5)16-7-17-42(39,40)41)24-9-10-25-30-26(20-28(37)32(24,25)3)31(2)13-12-23(35)18-22(31)19-27(30)36/h21-28,30,35-37H,6-20H2,1-5H3,(H-,33,38,39,40,41) |
||
| |
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
||
| StdInChIKey = UMCMPZBLKLEWAF- |
| StdInChIKey = UMCMPZBLKLEWAF-UHFFFAOYSA-N}} |
||
⚫ | |||
⚫ | |||
⚫ | |||
| CMC =8-10 mM |
|||
| HLB = |
|||
}} |
}} |
||
⚫ | |||
⚫ | |||
⚫ | |||
}} |
}} |
||
'''CHAPS''' is a [[zwitterion]]ic [[surfactant]] used in the laboratory to [[solubility|solubilize]] biological macromolecules such as [[protein]]s. It may be synthesized from [[cholic acid]]<ref>{{cite journal|last1=Hjelmeland|first1=LM|title=A nondenaturing zwitterionic detergent for membrane biochemistry: design and synthesis.|journal=Proceedings of the National Academy of Sciences of the United States of America|date=November 1980|volume=77|issue=11|pages=6368–70|pmid=6935651|doi=10.1073/pnas.77.11.6368|pmc=350285|bibcode=1980PNAS...77.6368H|doi-access=free}}</ref> and is zwitterionic due to its [[quaternary ammonium]] and [[sulfonate]] groups; it is structurally similar to certain [[bile acid]]s, such as [[taurodeoxycholic acid]] and [[taurochenodeoxycholic acid]]. It is used as a non-[[Denaturation (biochemistry)|denaturing]] detergent in the process of [[protein purification]] and is especially useful in purifying [[membrane protein]]s, which are often sparingly soluble or insoluble in [[aqueous]] solution due to their native [[hydrophobic|hydrophobicity]].<ref name="CladeraRicaud1997">{{cite journal|last1=Cladera|first1=Josep|last2=Ricaud|first2=Jean-Louis|last3=Verde|first3=Joaquim Villa|last4=DuNach|first4=Mireia|title=Liposome Solubilization and Membrane Protein Reconstitution Using Chaps and Chapso|journal=European Journal of Biochemistry|volume=243|issue=3|year=1997|pages=798–804|doi=10.1111/j.1432-1033.1997.00798.x|pmid=9057848|doi-access=free}}</ref> |
|||
CHAPS is an abbreviation for 3-[(3-'''ch'''olamidopropyl)dimethyl'''a'''mmonio]-1-'''p'''ropane'''s'''ulfonate. A related detergent, called CHAPSO, has the same basic chemical structure with an additional [[hydroxyl]] [[functional group]]; its full chemical name is 3-[(3-cholamidopropyl)dimethylammonio]-2-hydroxy-1-propanesulfonate. Both detergents have low light absorbance in the [[ultraviolet]] region of the [[electromagnetic spectrum]], which is useful for monitoring ongoing [[chemical reaction]]s or [[protein-protein interaction|protein-protein binding]] with [[UV/Vis spectroscopy]]. |
|||
==See also== |
|||
* [[Taurodeoxycholic acid]] |
|||
* [[Taurochenodeoxycholic acid]] |
|||
==References== |
|||
{{Reflist}} |
|||
[[Category:Steroids]] |
|||
[[Category:Biochemistry methods]] |
|||
[[Category:Zwitterionic surfactants]] |