Jump to content

Calcium glycerylphosphate: Difference between revisions

Page 1
Page 2
Content deleted Content added
CheMoBot (talk | contribs)
Updating {{chembox}}, {{drugbox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report [[Wiki
Added solubility in water. Temperature unknown.
 
(19 intermediate revisions by 14 users not shown)
Line 1: Line 1:
{{more citations needed|date=January 2021}}
{{Chembox
{{Chembox
| Watchedfields = changed
| verifiedrevid = 443494785
| verifiedrevid = 443495906
| ImageFile = calcium glycerylphosphate.png
| ImageFile = calcium glycerylphosphate.png
| ImageSize = 200px
| ImageAlt =
| PIN = Calcium 1,3-dihydroxypropan-2-yl phosphate
| ImageAlt =
| IUPACName = Calcium 1,3-dihydroxypropan-2-yl phosphate
| OtherNames =
| OtherNames =
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| CASNo = 27214-00-2
| CASNo = 27214-00-2
| CASNo_Ref = {{cascite|correct}}
| CASNo_Ref = {{cascite|correct|??}}
| UNII_Ref = {{fdacite|correct|FDA}}
| PubChem = 62820
| UNII = XWV9Z12C1C
| ChEBI_Ref = {{ebicite|correct|EBI}}
| PubChem = 62820
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 31336
| ChEBI = 31336
| SMILES = [Ca+2].[O-]P([O-])(=O)OC(CO)CO
| SMILES = [Ca+2].[O-]P([O-])(=O)OC(CO)CO
| ChEMBL = 3707206
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 56554
| ChemSpiderID = 56554
| InChI = 1/C3H9O6P.Ca/c4-1-3(2-5)9-10(6,7)8;/h3-5H,1-2H2,(H2,6,7,8);/q;+2/p-2
| DrugBank = DB11264
| InChIKey = UHHRFSOMMCWGSO-NUQVWONBAR
| EC_number = 261-240-1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| KEGG = C12935
| StdInChI = 1S/C3H9O6P.Ca/c4-1-3(2-5)9-10(6,7)8;/h3-5H,1-2H2,(H2,6,7,8);/q;+2/p-2
| InChI = 1/C3H9O6P.Ca/c4-1-3(2-5)9-10(6,7)8;/h3-5H,1-2H2,(H2,6,7,8);/q;+2/p-2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = UHHRFSOMMCWGSO-UHFFFAOYSA-L
| InChIKey = UHHRFSOMMCWGSO-NUQVWONBAR
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| ATCvet =
| StdInChI = 1S/C3H9O6P.Ca/c4-1-3(2-5)9-10(6,7)8;/h3-5H,1-2H2,(H2,6,7,8);/q;+2/p-2
| ATCCode_prefix = A12
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| ATCCode_suffix = AA08
| StdInChIKey = UHHRFSOMMCWGSO-UHFFFAOYSA-L
| ATC_Supplemental =
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| C=3|H=7|Ca=1|O=6|P=1
| C=3 | H=7 | Ca=1 | O=6 | P=1
| Appearance =
| Appearance =
| Density =
| Density =
| MeltingPt =
| MeltingPt =
| BoilingPt =
| BoilingPt =
| Solubility = 54.3 g/L<ref>{{cite web|url=https://foodb.ca/compounds/FDB009054|title=Showing Compound Calcium glycerophosphate (FDB009054) - FooDB }}</ref>}}
| Solubility = }}
| Section3 = {{Chembox Hazards
|Section6={{Chembox Pharmacology
| MainHazards =
| ATCCode_prefix = A12
| FlashPt =
| ATCCode_suffix = AA08
}}
| Autoignition = }}
|Section7={{Chembox Hazards
| GHSPictograms = {{GHS07}}
| GHSSignalWord = Warning
| HPhrases = {{H-phrases|315|319|335}}
| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}}
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
}}


'''Calcium glycerylphosphate''' (or '''calcium glycerophosphate''') is a [[Dietary mineral|mineral supplement]].
'''Calcium glycerylphosphate''' (or '''calcium glycerophosphate''') is a [[Dietary mineral|mineral supplement]]. Formerly it was sold as a nerve tonic. It is added to some kinds of [[toothpaste]].<ref>{{cite web |title=Calcium glycerophosphate |url=https://www.drugbank.ca/drugs/DB11264 |website=www.drugbank.ca}}</ref>



==References==
{{Reflist}}


{{Mineral supplements}}
{{Mineral supplements}}
{{Calcium compounds}}


[[Category:Calcium compounds]]
[[Category:Calcium compounds]]
Line 50: Line 63:


{{gastrointestinal-drug-stub}}
{{gastrointestinal-drug-stub}}

[[ar:فوسفات غليسيريل الكالسيوم]]