Calcium glycerylphosphate: Difference between revisions
Appearance
Content deleted Content added
Updating {{chembox}}, {{drugbox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report [[Wiki |
Added solubility in water. Temperature unknown. |
||
(19 intermediate revisions by 14 users not shown) | |||
Line 1: | Line 1: | ||
{{more citations needed|date=January 2021}} |
|||
{{Chembox |
{{Chembox |
||
| Watchedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 443495906 |
||
| ImageFile = calcium glycerylphosphate.png |
| ImageFile = calcium glycerylphosphate.png |
||
| |
| ImageAlt = |
||
⚫ | |||
| ImageAlt = |
|||
⚫ | |||
| OtherNames = |
| OtherNames = |
||
| |
|Section1={{Chembox Identifiers |
||
| |
| CASNo = 27214-00-2 |
||
| |
| CASNo_Ref = {{cascite|correct|??}} |
||
⚫ | |||
⚫ | |||
| UNII = XWV9Z12C1C |
|||
⚫ | |||
⚫ | |||
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|||
| ChEBI = 31336 |
| ChEBI = 31336 |
||
| SMILES = [Ca+2].[O-]P([O-])(=O)OC(CO)CO |
| SMILES = [Ca+2].[O-]P([O-])(=O)OC(CO)CO |
||
| ChEMBL = 3707206 |
|||
| |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| |
| ChemSpiderID = 56554 |
||
⚫ | |||
| DrugBank = DB11264 |
|||
⚫ | |||
| EC_number = 261-240-1 |
|||
⚫ | |||
| KEGG = C12935 |
|||
⚫ | |||
⚫ | |||
⚫ | |||
| |
| InChIKey = UHHRFSOMMCWGSO-NUQVWONBAR |
||
⚫ | |||
⚫ | |||
⚫ | |||
| ATCCode_prefix = A12 |
|||
⚫ | |||
| ATCCode_suffix = AA08 |
|||
⚫ | |||
| ATC_Supplemental = |
|||
}} |
}} |
||
| |
|Section2={{Chembox Properties |
||
| |
| C=3 | H=7 | Ca=1 | O=6 | P=1 |
||
| |
| Appearance = |
||
| |
| Density = |
||
| |
| MeltingPt = |
||
| |
| BoilingPt = |
||
| Solubility = 54.3 g/L<ref>{{cite web|url=https://foodb.ca/compounds/FDB009054|title=Showing Compound Calcium glycerophosphate (FDB009054) - FooDB }}</ref>}} |
|||
| Solubility = }} |
|||
| |
|Section6={{Chembox Pharmacology |
||
| |
| ATCCode_prefix = A12 |
||
| |
| ATCCode_suffix = AA08 |
||
}} |
|||
| Autoignition = }} |
|||
|Section7={{Chembox Hazards |
|||
| GHSPictograms = {{GHS07}} |
|||
| GHSSignalWord = Warning |
|||
| HPhrases = {{H-phrases|315|319|335}} |
|||
| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}} |
|||
| MainHazards = |
|||
⚫ | |||
| AutoignitionPt = }} |
|||
}} |
}} |
||
'''Calcium glycerylphosphate''' (or '''calcium glycerophosphate''') is a [[Dietary mineral|mineral supplement]]. |
'''Calcium glycerylphosphate''' (or '''calcium glycerophosphate''') is a [[Dietary mineral|mineral supplement]]. Formerly it was sold as a nerve tonic. It is added to some kinds of [[toothpaste]].<ref>{{cite web |title=Calcium glycerophosphate |url=https://www.drugbank.ca/drugs/DB11264 |website=www.drugbank.ca}}</ref> |
||
==References== |
|||
{{Reflist}} |
|||
{{Mineral supplements}} |
{{Mineral supplements}} |
||
{{Calcium compounds}} |
|||
[[Category:Calcium compounds]] |
[[Category:Calcium compounds]] |
||
Line 50: | Line 63: | ||
{{gastrointestinal-drug-stub}} |
{{gastrointestinal-drug-stub}} |
||
[[ar:فوسفات غليسيريل الكالسيوم]] |