Jump to content

Dichlorofluorescein: Difference between revisions

Page 1
Page 2
Content deleted Content added
Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'StdInChI').
Citation bot (talk | contribs)
Add: pmid. | Use this bot. Report bugs. | Suggested by Abductive | Category:Multiple chemicals in an infobox that need indexing | #UCB_Category 599/1863
 
(31 intermediate revisions by 22 users not shown)
Line 1: Line 1:
{{Chembox
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 460782986
| ImageFile = Dichlorofluorescein.svg
| ImageFile = Dichlorofluorescein.svg
| ImageSize = 205
| ImageSize = 205
| IUPACName = 2',7'-dichloro-3',6'-dihydroxy-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one
| PIN = 2′,7′-Dichloro-3′,6′-dihydroxy-3''H''-spiro[<nowiki/>[2]benzofuran-1,9′-xanthen]-3-one
| OtherNames =
| OtherNames =
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| InChI = 1/C20H10Cl2O5/c21-13-5-11-17(7-15(13)23)26-18-8-16(24)14(22)6-12(18)20(11)10-4-2-1-3-9(10)19(25)27-20/h1-8,23-24H
| InChI = 1/C20H10Cl2O5/c21-13-5-11-17(7-15(13)23)26-18-8-16(24)14(22)6-12(18)20(11)10-4-2-1-3-9(10)19(25)27-20/h1-8,23-24H
| InChIKey = VFNKZQNIXUFLBC-UHFFFAOYAO
| InChIKey = VFNKZQNIXUFLBC-UHFFFAOYAO
| InChI1 = 1S/C20H10Cl2O5/c21-13-5-11-17(7-15(13)23)26-18-8-16(24)14(22)6-12(18)20(11)10-4-2-1-3-9(10)19(25)27-20/h1-8,23-24H
| InChI1 = 1S/C20H10Cl2O5/c21-13-5-11-17(7-15(13)23)26-18-8-16(24)14(22)6-12(18)20(11)10-4-2-1-3-9(10)19(25)27-20/h1-8,23-24H
| InChIKey1 = VFNKZQNIXUFLBC-UHFFFAOYSA-N
| InChIKey1 = VFNKZQNIXUFLBC-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo =
| PubChem = 64944
| CASNo = 76-54-0
| UNII_Ref = {{fdacite|correct|FDA}}
| ChemSpiderID = 58471
| ChEBI = 51596
| UNII = 56NQM5UZT1
| PubChem = 64944
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 58471
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 51596
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1908059
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = VFNKZQNIXUFLBC-UHFFFAOYSA-N
| StdInChIKey = VFNKZQNIXUFLBC-UHFFFAOYSA-N
| SMILES = Clc5cc4c(Oc1cc(O)c(Cl)cc1C34OC(=O)c2c3cccc2)cc5O
| SMILES = Clc5cc4c(Oc1cc(O)c(Cl)cc1C34OC(=O)c2c3cccc2)cc5O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C20H10Cl2O5/c21-13-5-11-17(7-15(13)23)26-18-8-16(24)14(22)6-12(18)20(11)10-4-2-1-3-9(10)19(25)27-20/h1-8,23-24H
| StdInChI = 1S/C20H10Cl2O5/c21-13-5-11-17(7-15(13)23)26-18-8-16(24)14(22)6-12(18)20(11)10-4-2-1-3-9(10)19(25)27-20/h1-8,23-24H
}}
|Section2={{Chembox Properties
| C=20| H=10| Cl=2| O=5
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
}}
'''Dichlorofluorescein''' (DCF) is an organic dye of the [[fluorescein]] family, being substituted at the 2 and 7 positions by chloride.
| Section2 = {{Chembox Properties
| C = 20
| H = 10
| Cl = 2
| O = 5
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| Autoignition =
}}
}}
'''Dichlorofluorescein''' is an [[organic dye]] of the [[fluorescein]] family, being substituted at the 2 and 7 positions by chloride. It is used as an indicator for [[argentometry#Fajans method|argentometry by Fajans method]].<ref>{{cite journal | last1 = Kolthoff | first1 = I. M. | last2 = Lauer | first2 = W. M. | last3 = Sunde | first3 = C. J. | journal = Journal of the American Chemical Society | volume = 51 | pages = 3273 | year = 1929 | doi = 10.1021/ja01386a014 | title =The Use of Dichlorofluorescein as an Adsorption Indicator for the Argentometric Titration of Chlorides | issue = 11}}</ref><ref>{{cite journal | last1 =Bambach | first1 =Karl | last2 =Rider | first2 =T. H. | title =Volumetric Determinations of Halides: Use of Dichlorofluorescein as an Adsorption Indicator | journal =Industrial & Engineering Chemistry Analytical Edition | volume =7 | pages =165 | year =1935 | doi =10.1021/ac50095a012 | issue =3}}</ref>


It is used as an indicator for [[argentometry#Fajans method|argentometry by Fajans method]].<ref>{{cite journal | last1 = Kolthoff | first1 = I. M. | last2 = Lauer | first2 = W. M. | last3 = Sunde | first3 = C. J. | journal = Journal of the American Chemical Society | volume = 51 | pages = 3273 | year = 1929 | doi = 10.1021/ja01386a014 | title =The Use of Dichlorofluorescein as an Adsorption Indicator for the Argentometric Titration of Chlorides | issue = 11}}</ref><ref>{{cite journal | last1 =Bambach | first1 =Karl | last2 =Rider | first2 =T. H. | title =Volumetric Determinations of Halides: Use of Dichlorofluorescein as an Adsorption Indicator | journal =Industrial & Engineering Chemistry Analytical Edition | volume =7 | pages =165 | year =1935 | doi =10.1021/ac50095a012 | issue =3}}</ref>
==References==
{{Reflist}}


When used as an indicator, upon reaching the equivalence point of a titration reaction the color shifts from colorless towards a faint pink.
[[Category:Dyes]]

It is also used in the [[cellular antioxidant activity]] (CAA) assay. Dichlorofluorescin (DCFH) is a probe that is trapped within cells and is easily oxidized to fluorescent dichlorofluorescein (DCF). The method measures the ability of compounds to prevent the formation of DCF by [[2,2'-Azobis(2-amidinopropane) dihydrochloride]] (ABAP)-generated peroxyl radicals in human hepatocarcinoma [[HepG2]] cells.<ref>{{Cite journal | last1 = Wolfe | first1 = K. L. | last2 = Liu | first2 = R. H. | doi = 10.1021/jf0715166 | title = Cellular Antioxidant Activity (CAA) Assay for Assessing Antioxidants, Foods, and Dietary Supplements | journal = Journal of Agricultural and Food Chemistry | volume = 55 | issue = 22 | pages = 8896–8907 | year = 2007 | pmid = 17902627}}</ref> By itself, dichlorofluorescin (DCFH) also quantifies intracellular hydrogen peroxide as well as cellular [[oxidative stress]].<ref>{{Cite journal | last1 = LeBel | first1 = C. P. | last2 = Ischiropoulos | first2 = Harry | last3 = Bondy | first3 = S. C. | doi = 10.1021/tx00026a012 | title = Evaluation of the probe 2',7'-dichlorofluorescin as an indicator of reactive oxygen species formation and oxidative stress | journal = Chem. Res. Toxicol. | volume = 5 | issue = 2 | pages = 227–231 | year = 1992 | pmid = 1322737 | url = https://escholarship.org/content/qt19r571vt/qt19r571vt.pdf?t=nsppk9 }}</ref>

== References ==
{{Reflist}}


[[Category:Fluorone dyes]]
[[de:2,7-Dichlorfluorescein]]
[[Category:Chloroarenes]]
[[Category:Spiro compounds]]
[[Category:Hydroxyarenes]]
[[Category:Triarylmethane dyes]]