Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Rhodium(II) acetate: Difference between pages

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 464381848

| Name = Rhodium(II) acetate

| ImageFile1 = Rhodium(II)-acetate-hydrate-dimer-from-xtal-1971-3D-balls.png

| ImageFile2 = Rhodium(II) acetate.jpg

| ImageName = Rhodium(II) acetate

| IUPACName = Rhodium(II) acetate

| OtherNames = Dirhodium tetraacetate,<br />Tetrakis(acetato)dirhodium(II),<br />Rhodium diacetate dimer,<br />Tetrakis(''μ''-acetato)dirhodium

|Section1={{Chembox Identifiers

| SMILES = [OH2][Rh+3]1234#[Rh+3]([OH2])(O[C-](C)O1)(O[C-](C)O2)(O[C-](C)O3)O[C-](C)O4

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| PubChem = 152122

| InChI = 1S/4C2H4O2.2Rh/c4*1-2(3)4;;/h4*1H3,(H,3,4);;/q;;;;2*+2/p-4

| InChIKey = : SYBXSZMNKDOUCA-UHFFFAOYSA-J

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = NK3058Z56X

| RTECS = VI9361000

| EINECS = 240-084-8

|Section2={{Chembox Properties

| Formula = C₈H₁₂O₈Rh₂

| MolarMass = 441.99 g/mol

| Appearance = Emerald green powder

| Density = 1.126 g/cm³

| Solubility = soluble

| Solvent = other solvents

| SolubleOther = polar organic solvents

| MeltingPt = >100 °C

| BoilingPt = decomposes

}}

|Section3={{Chembox Structure

| Coordination = [[octahedral]]

| CrystalStruct = [[monoclinic]]

| Dipole = 0 [[Debye|D]]

}}

|Section7={{Chembox Hazards

| ExternalSDS = [http://www.coleparmer.in/catalog/Msds/95104.htm Coleparmer MSDS]

| NFPA-H = 3

| NFPA-R = 0

| NFPA-F = 0

| FlashPt = low flammability

| GHS_ref=<ref>{{cite web |title=Dirhodium tetraacetate |url=https://pubchem.ncbi.nlm.nih.gov/compound/152122#section=Safety-and-Hazards |website=pubchem.ncbi.nlm.nih.gov |access-date=14 December 2021 |language=en}}</ref>

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|315|319}}

| PPhrases = {{P-phrases|264|280|302+352|305+351+338|321|332+313|337+313|362}}

}}

|Section8={{Chembox Related

| OtherCompounds = [[Copper(II) acetate]]<br />[[Chromium(II) acetate]]

}}

}}

'''Rhodium(II) acetate''' is the [[coordination compound]] with the [[chemical formula|formula]] [[Rhodium|Rh]]₂(AcO)₄, where AcO⁻ is the [[acetate]] ion ({{chem|CH|3|CO|2|−}}). This dark green powder is slightly soluble in polar solvents, including water. It is used as a catalyst for [[cyclopropanation]] of [[alkene]]s. It is a widely studied example of a [[transition metal carboxylate complex]].<ref name=Felthouse/>

==Preparation==

Rhodium(II) acetate is usually prepared by the heating of [[Water of crystallization|hydrated]] [[rhodium(III) chloride]] in a methanol-[[acetic acid]] mixture. The crude product is the bis(methanol) complex, but it is easily desolvated.<ref name=Felthouse>{{cite book |doi=10.1002/9780470166307.ch2 |chapter=The Chemistry, Structure, and Metal-Metal Bonding in Compounds of Rhodium(II) |title=Progress in Inorganic Chemistry |date=1982 |last1=Felthouse |first1=Timothy R. |volume=29 |pages=73–166 |isbn=978-0-471-09370-1 }}</ref><ref>{{Cite book | last1 = Rempel | first1 = G. A. | last2 = Legzdins | first2 = P. | last3 = Smith | first3 = H. | last4 = Wilkinson | first4 = G. | title = Inorganic Syntheses | chapter = Tetrakis(acetato)dirhodium(II) and Similar Carboxylato Compounds | doi = 10.1002/9780470132449.ch16 | journal = [[Inorg. Synth.]] | volume = 13 | pages = 90–91 | year = 1972 | isbn = 9780470132449 }}</ref>

==Structure and properties==

The structure of rhodium(II) acetate features a pair of [[rhodium]] atoms, each with [[octahedral molecular geometry]], defined by four acetate oxygen atoms, water, and a Rh–Rh bond of length 2.39&nbsp;[[Ångström|Å]]. The water [[adduct]] is exchangeable, and a variety of other [[Lewis base]]s bind to the axial positions.<ref>{{Cite journal | last1 = Cotton | first1 = F. A. | last2 = Deboer | first2 = B. G. | last3 = Laprade | first3 = M. D. | last4 = Pipal | first4 = J. R. | last5 = Ucko | first5 = D. A. | title = The crystal and molecular structures of dichromium tetraacetate dihydrate and dirhodium tetraacetate dihydrate | doi = 10.1107/S0567740871004527 | journal = Acta Crystallogr B | volume = 27 | issue = 8 | pages = 1664 | year = 1971 | doi-access = }}</ref> [[Copper(II) acetate]] and [[chromium(II) acetate]] adopt [[Chinese lantern structure|similar structures]].

==Chemical properties==

The dimer binds a number of classical [[Lewis base]]s to form 2:1 adducts:

Its [[Lewis acidity]] is eclipsed by the enhanced reactivity of [[rhodium(II) trifluoroacetate]], which even binds arenes and alkenes.

The acetate group can be replaced by other carboxylates of strong acids. The yields are nearly quantitative.

Like almost all rhodium complexes, rhodium(II) acetate catalyzes many reactions such as hydrogenation and hydrosilylation. No evidence exists for mechanisms and the behavior has not motivated further work. The important observation that rhodium(II) acetate catalyzes reactions of diazo compounds has led to considerable research, but mostly focused on the trifluoroacetate or chiral derivatives.

==References==

{{Reflist}}

{{Rhodium compounds}}

{{Acetates}}

{{DEFAULTSORT:Rhodium(II) Acetate}}

[[Category:Rhodium(II) compounds]]

[[Category:Acetates]]

[[Category:Dimers (chemistry)]]

[[Category:Chemical compounds containing metal–metal bonds]]