Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Sulfonmethane: Difference between pages
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 447903828 of page Sulfonmethane for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Plutonium27 (talk | contribs) →Effects: rem para -evidently copied from a contemporary manufacturers or prescribing manual or some such, and is not WP:RS |
||
| Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Sulfonmethane|oldid=447903828}} 447903828] of page [[Sulfonmethane]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 470473789 |
||
| IUPAC_name = 2,2-bis(ethylsulfonyl)propane |
| IUPAC_name = 2,2-bis(ethylsulfonyl)propane |
||
| image = |
| image = Sulfonal.svg |
||
| width = |
| width = 200 |
||
| image2 = Sulfonal-3D- |
| image2 = Sulfonal-3D-sticks.png |
||
<!--Clinical data--> |
<!--Clinical data--> |
||
| Line 17: | Line 18: | ||
| legal_US = Schedule III |
| legal_US = Schedule III |
||
| legal_status = |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| Line 24: | Line 25: | ||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|changed|??}} |
|||
| CAS_number = |
| CAS_number = 115-24-2 |
||
| ATC_prefix = none |
| ATC_prefix = none |
||
| ATC_suffix = |
| ATC_suffix = |
||
| Line 38: | Line 40: | ||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=7 | H=16 | O=4 | S=2 |
| C=7 | H=16 | O=4 | S=2 |
||
| molecular_weight = 228.3295 g/mol |
|||
| smiles = O=S(=O)(C(C)(C)S(=O)(=O)CC)CC |
| smiles = O=S(=O)(C(C)(C)S(=O)(=O)CC)CC |
||
| InChI = 1/C7H16O4S2/c1-5-12(8,9)7(3,4)13(10,11)6-2/h5-6H2,1-4H3 |
|||
| InChIKey = CESKLHVYGRFMFP-UHFFFAOYAW |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C7H16O4S2/c1-5-12(8,9)7(3,4)13(10,11)6-2/h5-6H2,1-4H3 |
| StdInChI = 1S/C7H16O4S2/c1-5-12(8,9)7(3,4)13(10,11)6-2/h5-6H2,1-4H3 |
||
| Line 49: | Line 48: | ||
| melting_high = |
| melting_high = |
||
}} |
}} |
||
'''Sulfonmethane''' ('''sulfonomethane''', '''sulfonal''', '''acetone diethyl sulfone''')<ref>DE Patent 46333</ref> is a chemical compound first synthesized by Eugen Baumann in 1888 and introduced as a [[hypnotic]] drug by Alfred Kast later on, but now superseded by newer and safer sedatives.<ref>[http://www.thefreedictionary.com/sulfonmethane American Heritage Dictionary]</ref> Its appearance is either in colorless crystalline or powdered form. In United States, it is scheduled as a [[Controlled Substances Act#Schedule III controlled substances|Schedule III]] drug in the [[Controlled Substance Act]].<ref>{{cite web | url = http://www.usdoj.gov/dea/pubs/scheduling.html | title = DEA Scheduling }}</ref> |
|||
== Chemistry == |
|||
Sulfonal is prepared by condensing [[acetone]] with [[ethyl mercaptan]] in the presence of [[hydrochloric acid]], the mercaptol (CH<sub>3</sub>)<sub>2</sub>C(SC<sub>2</sub>H<sub>5</sub>)<sub>2</sub> formed being subsequently [[oxidize]]d by [[potassium permanganate]]. It is also formed by the action of [[Alcohol (chemistry)|alcohol]]ic [[potash]] and [[methyl iodide]] on ethylidene diethyl sulfine, CH<sub>3</sub>CH(SO<sub>2</sub>C<sub>2</sub>H<sub>5</sub>)<sub>2</sub> (which is formed by the oxidation of dithioacetal with [[potassium permanganate]]). It [[crystallize]]s in [[prism (geometry)|prisms]] melting at 125 C, which are practically insoluble in cold water, but dissolves in 15 parts of hot water and also in [[ethanol|alcohol]] and [[diethyl ether|ether]]. |
|||
== See also == |
|||
* [[Trional]] |
|||
* [[Tetronal]] |
|||
== References == |
|||
{{Reflist}} |
|||
== Further reading == |
|||
{{refbegin}} |
|||
* {{cite book | vauthors = Kast A | date = 1888 | title = Sulfonal, ein neues Schlafmittel | language = German | location = Berlin }} |
|||
* {{cite journal | vauthors = Wendt EC | date = 1888 | url = https://books.google.com/books?id=qUzlAAAAMAAJ&pg=PA597 | title = Sulfonal, a new Hypnotic | journal = The Medical Record | location = New York | volume = 33 | issue = 22 | pages = 597–598 }} |
|||
* {{cite journal | author = Bayer | title = Sulfonal | date = 1889 | url = https://archive.org/stream/cincinnatilance00culbgoog/#page/n46/mode/2up/ | journal = The Cincinnati Lancet-Clinic | location = Cincinnati | publisher = J. C. Culbertson | volume = 22 | pages = 2 }} |
|||
{{refend}} |
|||
{{Hypnotics}} |
|||
{{General anesthetics}} |
|||
{{GABAAR PAMs}} |
|||
[[Category:Hypnotics]] |
|||
[[Category:Sulfones]] |
|||
[[Category:GABAA receptor positive allosteric modulators]] |
|||