Prijeđi na sadržaj

S-14,671

Izvor: Wikipedija
S-14,671
(IUPAC) ime
N-{2-[4-(7-metoksinaftalen-1-il)piperazin-1-il]etil
Klinički podaci
Identifikatori
ATC kod ?
Hemijski podaci
Formula ?
Farmakoinformacioni podaci
Trudnoća ?
Pravni status

tiofen-2-karboksamid

| image = S-14671-structure.png | width = | image2 = | width2 =

| tradename = | pregnancy_category = | legal_status = | routes_of_administration =

| bioavailability = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  DaY | CAS_number = 135722-27-9 | ATC_prefix = none | ATC_suffix = | PubChem = 131907 | IUPHAR_ligand = | ChEMBL_Ref = | ChEMBL = | DrugBank_Ref = | DrugBank = | ChemSpiderID = 116529

| C=22 | H=25 | N=3 | O=2 | S=1 | molecular_weight = 395,52 g/mol | smiles = COC1=CC2=C(C=CC=C2N3CCN(CC3)CCNC(=O)C4=CC=CS4)C=C1 | InChI = | InChIKey = | StdInChI_Ref =  DaY | StdInChI = 1S/C22H25N3O2S/c1-27-18-8-7-17-4-2-5-20(19(17)16-18)25-13-11-24(12-14-25)10-9-23-22(26)21-6-3-15-28-21/h2-8,15-16H,9-14H2,1H3,(H,23,26) | StdInChIKey_Ref =  DaY | StdInChIKey = YFNZHCXOYLKDGU-UHFFFAOYSA-N }}

S-14,671 je naftilpiperazinski derivat koji deluje kao agonist 5-HT1A receptora (pKi = 9.3) sa visokom efikasnošću i izuzetnom in vivo potencijom. On je isto tako antagonist 5-HT2A i 5-HT2C receptor (oba imaju pKi = 7.8).[1][2] On pokazuje samo nizak afinitet za 5-HT1B i 5-HT3 receptore.[2]

Reference

[uredi | uredi kod]
  1. Millan MJ, Canton H, Rivet JM, Lejeune F, Laubie M, Lavielle G (October 1991). „S 14671: a novel naphthylpiperazine 5-HT1A agonist of high efficacy and exceptional in vivo potency”. European Journal of Pharmacology 203 (2): 319–22. DOI:10.1016/0014-2999(91)90734-8. PMID 1839284. 
  2. 2,0 2,1 Millan MJ, Rivet JM, Canton H, et al. (August 1992). „S 14671: a naphtylpiperazine 5-hydroxytryptamine1A agonist of exceptional potency and high efficacy possessing antagonist activity at 5-hydroxytryptamine1C/2 receptors”. The Journal of Pharmacology and Experimental Therapeutics 262 (2): 451–63. PMID 1323650. 

Povezano

[uredi | uredi kod]

Vanjske veze

[uredi | uredi kod]